CAS 82611-88-9 appears in our catalog under these names: ADPS/ 98.07% (existing batch purity), ADPS (ESPAS), N-Ethyl-N-(3-sulfopropyl)-3-methoxyaniline sodium, ADPS 97%, N-ETHYL-N-(3-SULFOPROPYL)-M-ANISIDINE. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 500mg, 1g, 10mM (in 1ml water), 5g, 2g, 10g, 250g, 1mg.
Sodium 3-(N-ethyl-3-methoxyanilino)propane-1-sulfonate (CAS 82611-88-9) is a chemical compound with the molecular formula C12H18NNaO4S and a molecular weight of 295.33 g/mol. IUPAC name: sodium 3-(N-ethyl-3-methoxyanilino)propane-1-sulfonate. InChIKey: MWFOPMKUGZLPQA-UHFFFAOYSA-M.
| Molecular formula | C12H18NNaO4S |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | sodium 3-(N-ethyl-3-methoxyanilino)propane-1-sulfonate |
| InChIKey | MWFOPMKUGZLPQA-UHFFFAOYSA-M |
| SMILES | CCN(CCCS(=O)(=O)[O-])C1=CC(=CC=C1)OC.[Na+] |
Computed by PubChem (NCBI)