CAS 634913-39-6 appears in our catalog under these names: AER-271/ 99.03% (existing batch purity), AER–271, AER-271, N-[3,5-Bis(trifluoromethyl)phenyl]-5-chloro-2-(phosphonooxy)benzamide, AER-271, 96.90%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
[2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] dihydrogen phosphate (CAS 634913-39-6) is a chemical compound with the molecular formula C15H9ClF6NO5P and a molecular weight of 463.65 g/mol. IUPAC name: [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] dihydrogen phosphate. InChIKey: WSHXPHFIHYXZKC-UHFFFAOYSA-N.
| Molecular formula | C15H9ClF6NO5P |
|---|---|
| Molecular weight | 463.65 g/mol |
| IUPAC name | [2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl]-4-chlorophenyl] dihydrogen phosphate |
| InChIKey | WSHXPHFIHYXZKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)NC2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)OP(=O)(O)O |
Computed by PubChem (NCBI)