CAS 1637300-25-4 appears in our catalog under these names: AF64394, AF64394/ 98.55% (existing batch purity), AF64394 98%, AF64394, 98.02%, N-(4-Chloro-2-isopropoxybenzyl)-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
N-[(4-chloro-2-propan-2-yloxyphenyl)methyl]-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (CAS 1637300-25-4) is a chemical compound with the molecular formula C21H20ClN5O and a molecular weight of 393.9 g/mol. IUPAC name: N-[(4-chloro-2-propan-2-yloxyphenyl)methyl]-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine. InChIKey: WBYNZQXAAWPAGR-UHFFFAOYSA-N.
| Molecular formula | C21H20ClN5O |
|---|---|
| Molecular weight | 393.9 g/mol |
| IUPAC name | N-[(4-chloro-2-propan-2-yloxyphenyl)methyl]-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | WBYNZQXAAWPAGR-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)Cl)CNC2=CC(=NC3=NC=NN23)C4=CC=CC=C4 |
Computed by PubChem (NCBI)