CAS 837364-57-5 appears in our catalog under these names: AG–024322, AG-024322/ 98.53% (existing batch purity), AG-024322, AG-024322, 98.69%, 98.69%, AG-024322, 98.53%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 2mg, 1mg, 25 mg, 50 mg.
N-[[5-[3-(4,6-difluoro-1H-benzimidazol-2-yl)-1H-indazol-5-yl]-4-methyl-3-pyridinyl]methyl]ethanamine (CAS 837364-57-5) is a chemical compound with the molecular formula C23H20F2N6 and a molecular weight of 418.4 g/mol. IUPAC name: N-[[5-[3-(4,6-difluoro-1H-benzimidazol-2-yl)-1H-indazol-5-yl]-4-methyl-3-pyridinyl]methyl]ethanamine. InChIKey: MEKASOQEXYKAKM-UHFFFAOYSA-N.
| Molecular formula | C23H20F2N6 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | N-[[5-[3-(4,6-difluoro-1H-benzimidazol-2-yl)-1H-indazol-5-yl]-4-methyl-3-pyridinyl]methyl]ethanamine |
| InChIKey | MEKASOQEXYKAKM-UHFFFAOYSA-N |
| SMILES | CCNCC1=CN=CC(=C1C)C2=CC3=C(C=C2)NN=C3C4=NC5=C(N4)C=C(C=C5F)F |
Computed by PubChem (NCBI)