CAS 1446711-81-4 appears in our catalog under these names: 3-(3-(3,5-Dimethyl-1H-pyrazol-4-yl)propoxy)-4-fluorobenzoic acid, AG-10/ 99.77% (existing batch purity), Acoramidis, Acoramidis 99%, Acoramidis, 98.47%. Offered by: Chemat, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 1mg, 1g, 5g, 5mg, 10mg, 25mg, 50mg, 100mg.
3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoic acid (CAS 1446711-81-4) is a chemical compound with the molecular formula C15H17FN2O3 and a molecular weight of 292.30 g/mol. IUPAC name: 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoic acid. InChIKey: WBFUHHBPNXWNCC-UHFFFAOYSA-N.
| Molecular formula | C15H17FN2O3 |
|---|---|
| Molecular weight | 292.30 g/mol |
| IUPAC name | 3-[3-(3,5-dimethyl-1H-pyrazol-4-yl)propoxy]-4-fluorobenzoic acid |
| InChIKey | WBFUHHBPNXWNCC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)CCCOC2=C(C=CC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)