CAS 149092-50-2 appears in our catalog under these names: AG 825, AG-825/ 98.43% (existing batch purity), Tyrphostin C15 , AG-825 99%, AG 825 1PC X 2MG. Offered by: GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 500mg, 10mM (in 1ml dmso).
(E)-3-[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-hydroxy-5-methoxyphenyl]-2-cyanoprop-2-enamide (CAS 149092-50-2) is a chemical compound with the molecular formula C19H15N3O3S2 and a molecular weight of 397.5 g/mol. IUPAC name: (E)-3-[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-hydroxy-5-methoxyphenyl]-2-cyanoprop-2-enamide. InChIKey: KXDONFLNGBQLTN-WUXMJOGZSA-N.
| Molecular formula | C19H15N3O3S2 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (E)-3-[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-hydroxy-5-methoxyphenyl]-2-cyanoprop-2-enamide |
| InChIKey | KXDONFLNGBQLTN-WUXMJOGZSA-N |
| SMILES | COC1=CC(=CC(=C1O)CSC2=NC3=CC=CC=C3S2)/C=C(\C#N)/C(=O)N |
Computed by PubChem (NCBI)