CAS 2377491-54-6 appears in our catalog under these names: AGI-43192/ 99.6% (existing batch purity), AGI–43192, AGI-43192 98%, AGI-43192, AGI-43192, 99.47%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
8-(4-chlorophenyl)-6-(2-methylindazol-5-yl)-2-(2,2,2-trifluoroethylamino)pyrido[4,3-d]pyrimidin-7-one (CAS 2377491-54-6) is a chemical compound with the molecular formula C23H16ClF3N6O and a molecular weight of 484.9 g/mol. IUPAC name: 8-(4-chlorophenyl)-6-(2-methylindazol-5-yl)-2-(2,2,2-trifluoroethylamino)pyrido[4,3-d]pyrimidin-7-one. InChIKey: XXCYDSDPIJJBSI-UHFFFAOYSA-N.
| Molecular formula | C23H16ClF3N6O |
|---|---|
| Molecular weight | 484.9 g/mol |
| IUPAC name | 8-(4-chlorophenyl)-6-(2-methylindazol-5-yl)-2-(2,2,2-trifluoroethylamino)pyrido[4,3-d]pyrimidin-7-one |
| InChIKey | XXCYDSDPIJJBSI-UHFFFAOYSA-N |
| SMILES | CN1C=C2C=C(C=CC2=N1)N3C=C4C=NC(=NC4=C(C3=O)C5=CC=C(C=C5)Cl)NCC(F)(F)F |
Computed by PubChem (NCBI)