cas: 1432660-47-3 — see every product listed under this CAS number, including other names
AGI-6780, 98%, 98% (CAS 1432660-47-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110C9T-1mg |
| cas | 1432660-47-3 |
| size | 1mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 136.40 Pln | |
| Chemat | 5mg | 146.00 Pln | |
| Chemat | 10mg | 208.40 Pln | |
| Chemat | 50mg | 491.60 Pln | |
| Chemat | 100mg | 842.00 Pln | |
| Chemat | 250mg | 1451.60 Pln | |
| Chemat | 1g | 3808.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[5-(cyclopropylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea (CAS 1432660-47-3) is a chemical compound with the molecular formula C21H18F3N3O3S2 and a molecular weight of 481.5 g/mol. IUPAC name: 1-[5-(cyclopropylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: CCAWRGNYALGPQH-UHFFFAOYSA-N.
| Molecular formula | C21H18F3N3O3S2 |
|---|---|
| Molecular weight | 481.5 g/mol |
| IUPAC name | 1-[5-(cyclopropylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | CCAWRGNYALGPQH-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC(=C(C=C2)C3=CSC=C3)NC(=O)NC4=CC=CC(=C4)C(F)(F)F |
Computed by PubChem (NCBI)