CAS 1432660-47-3 appears in our catalog under these names: N-CYCLOPROPYL-4-(THIOPHEN-3-YL)-3-(3-(3-(TRIFLUOROMETHYL)PHENYL)UREIDO)BENZENESULFONAMIDE, 98%, AGI-6780/ 98.19% (existing batch purity), AGI–6780, AGI-6780, 95%, AGI-6780 98%. Offered by: Fluorochem, TargetMol, GLPBio, Thermo Scientific (Acros), Ambeed. Available pack sizes: 5mg, 10mg, 50mg, 100mg, 250mg, 1g, 1mg, 2mg.
1-[5-(cyclopropylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea (CAS 1432660-47-3) is a chemical compound with the molecular formula C21H18F3N3O3S2 and a molecular weight of 481.5 g/mol. IUPAC name: 1-[5-(cyclopropylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: CCAWRGNYALGPQH-UHFFFAOYSA-N.
| Molecular formula | C21H18F3N3O3S2 |
|---|---|
| Molecular weight | 481.5 g/mol |
| IUPAC name | 1-[5-(cyclopropylsulfamoyl)-2-thiophen-3-ylphenyl]-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | CCAWRGNYALGPQH-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC(=C(C=C2)C3=CSC=C3)NC(=O)NC4=CC=CC(=C4)C(F)(F)F |
Computed by PubChem (NCBI)