CAS 304896-21-7 appears in our catalog under these names: AGK7/ 98.31% (existing batch purity), AGK7. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 1 mg.
(E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-quinolin-8-ylprop-2-enamide (CAS 304896-21-7) is a chemical compound with the molecular formula C23H13Cl2N3O2 and a molecular weight of 434.3 g/mol. IUPAC name: (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-quinolin-8-ylprop-2-enamide. InChIKey: WRDKBSLEHFRKGG-RVDMUPIBSA-N.
| Molecular formula | C23H13Cl2N3O2 |
|---|---|
| Molecular weight | 434.3 g/mol |
| IUPAC name | (E)-2-cyano-3-[5-(2,5-dichlorophenyl)furan-2-yl]-N-quinolin-8-ylprop-2-enamide |
| InChIKey | WRDKBSLEHFRKGG-RVDMUPIBSA-N |
| SMILES | C1=CC2=C(C(=C1)NC(=O)/C(=C/C3=CC=C(O3)C4=C(C=CC(=C4)Cl)Cl)/C#N)N=CC=C2 |
Computed by PubChem (NCBI)