CAS 681006-28-0 appears in our catalog under these names: AICAR phosphate/ 99.8% (existing batch purity), AICAR phosphate, AICAR (phosphate), AICAR (phosphate), 99.97%, AICAR (phosphate) (Standard), 99.98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 10mM (in 1ml water), 200mg, 50mg, 500mg, 1 g, 50 mg.
5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide;phosphoric acid (CAS 681006-28-0) is a chemical compound with the molecular formula C9H17N4O9P and a molecular weight of 356.23 g/mol. IUPAC name: 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide;phosphoric acid. InChIKey: BPVGMEHURDEDAZ-GWTDSMLYSA-N.
| Molecular formula | C9H17N4O9P |
|---|---|
| Molecular weight | 356.23 g/mol |
| IUPAC name | 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]imidazole-4-carboxamide;phosphoric acid |
| InChIKey | BPVGMEHURDEDAZ-GWTDSMLYSA-N |
| SMILES | C1=NC(=C(N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)C(=O)N.OP(=O)(O)O |
Computed by PubChem (NCBI)