CAS 420831-40-9 appears in our catalog under these names: AK-7/ 98.4% (existing batch purity), AK–7, AK-7, 3-(1-azepanylsulfonyl)-N-(3-bromophenyl)benzamide, AK-7 99%. Offered by: TargetMol, GLPBio, Chemat, Biosynth, Ambeed. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
3-(azepan-1-ylsulfonyl)-N-(3-bromophenyl)benzamide (CAS 420831-40-9) is a chemical compound with the molecular formula C19H21BrN2O3S and a molecular weight of 437.4 g/mol. IUPAC name: 3-(azepan-1-ylsulfonyl)-N-(3-bromophenyl)benzamide. InChIKey: IYAYHZZWYNXHEQ-UHFFFAOYSA-N.
| Molecular formula | C19H21BrN2O3S |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | 3-(azepan-1-ylsulfonyl)-N-(3-bromophenyl)benzamide |
| InChIKey | IYAYHZZWYNXHEQ-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)NC3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)