CAS 2036272-55-4 appears in our catalog under these names: ALC-0315/ 99.89% (existing batch purity), ALC–0315, ALC-0315, ALC-0315, 95%, ALC-0315 97%. Offered by: TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500MG, 250mg, 1g.
6-[6-(2-hexyldecanoyloxy)hexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate (CAS 2036272-55-4) is a chemical compound with the molecular formula C48H95NO5 and a molecular weight of 766.3 g/mol. IUPAC name: 6-[6-(2-hexyldecanoyloxy)hexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate. InChIKey: QGWBEETXHOVFQS-UHFFFAOYSA-N.
| Molecular formula | C48H95NO5 |
|---|---|
| Molecular weight | 766.3 g/mol |
| IUPAC name | 6-[6-(2-hexyldecanoyloxy)hexyl-(4-hydroxybutyl)amino]hexyl 2-hexyldecanoate |
| InChIKey | QGWBEETXHOVFQS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCCO |
Computed by PubChem (NCBI)