CAS 2231081-18-6 appears in our catalog under these names: ALDH1A1-IN-2/ 99.48% (existing batch purity), ALDH1A1–IN–2, ALDH1A1-IN-2, ALDH1A1-IN-2, 99.31%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 5 mg, 25 mg, 100 mg, 10 mg.
1-[4-[6-chloro-3-(4-methylsulfonylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]cyclopropane-1-carbonitrile (CAS 2231081-18-6) is a chemical compound with the molecular formula C25H23ClN4O3S and a molecular weight of 495.0 g/mol. IUPAC name: 1-[4-[6-chloro-3-(4-methylsulfonylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]cyclopropane-1-carbonitrile. InChIKey: MIVWUIQZCQTJER-UHFFFAOYSA-N.
| Molecular formula | C25H23ClN4O3S |
|---|---|
| Molecular weight | 495.0 g/mol |
| IUPAC name | 1-[4-[6-chloro-3-(4-methylsulfonylpiperazine-1-carbonyl)quinolin-4-yl]phenyl]cyclopropane-1-carbonitrile |
| InChIKey | MIVWUIQZCQTJER-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)C(=O)C2=CN=C3C=CC(=CC3=C2C4=CC=C(C=C4)C5(CC5)C#N)Cl |
Computed by PubChem (NCBI)