CAS 761436-81-1 appears in our catalog under these names: ALK Inhibitor 1, ALK inhibitor 1, 99.16%, ALK inhibitor 1/ 98.55% (existing batch purity). Offered by: Biosynth, Chemat, MedChemExpress, TargetMol. Available pack sizes: 50mg, 25mg, 1mg, 100mg, 5mg, 10mg, 10mM/1mL, 5 mg.
2-[[5-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide (CAS 761436-81-1) is a chemical compound with the molecular formula C23H28BrN7O3S and a molecular weight of 562.5 g/mol. IUPAC name: 2-[[5-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide. InChIKey: FTSDLONCFCQDGA-UHFFFAOYSA-N.
| Molecular formula | C23H28BrN7O3S |
|---|---|
| Molecular weight | 562.5 g/mol |
| IUPAC name | 2-[[5-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-methylbenzenesulfonamide |
| InChIKey | FTSDLONCFCQDGA-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=CC=C1NC2=NC(=NC=C2Br)NC3=C(C=C(C=C3)N4CCN(CC4)C)OC |
Computed by PubChem (NCBI)