CAS 1445379-92-9 appears in our catalog under these names: ALS-8112/ 98.9% (existing batch purity), ALS–8112, ALS-8112, ALS-8112, 99.40%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg, 10mM/1mL.
4-amino-1-[(2R,3R,4R,5R)-5-(chloromethyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one (CAS 1445379-92-9) is a chemical compound with the molecular formula C10H13ClFN3O4 and a molecular weight of 293.68 g/mol. IUPAC name: 4-amino-1-[(2R,3R,4R,5R)-5-(chloromethyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one. InChIKey: AWSRKKBIPSQHOJ-IBCQBUCCSA-N.
| Molecular formula | C10H13ClFN3O4 |
|---|---|
| Molecular weight | 293.68 g/mol |
| IUPAC name | 4-amino-1-[(2R,3R,4R,5R)-5-(chloromethyl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
| InChIKey | AWSRKKBIPSQHOJ-IBCQBUCCSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@](O2)(CO)CCl)O)F |
Computed by PubChem (NCBI)