CAS 1416799-28-4 appears in our catalog under these names: AMG 333/ 99.08% (existing batch purity), AMG 333, AMG 333, AMG 333 99%, AMG-333, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10mM (in 1ml dmso).
6-[[(S)-(3-fluoro-2-pyridinyl)-[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]carbamoyl]pyridine-3-carboxylic acid (CAS 1416799-28-4) is a chemical compound with the molecular formula C20H12F5N3O4 and a molecular weight of 453.3 g/mol. IUPAC name: 6-[[(S)-(3-fluoro-2-pyridinyl)-[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]carbamoyl]pyridine-3-carboxylic acid. InChIKey: QEBYISWYMFIXOZ-INIZCTEOSA-N.
| Molecular formula | C20H12F5N3O4 |
|---|---|
| Molecular weight | 453.3 g/mol |
| IUPAC name | 6-[[(S)-(3-fluoro-2-pyridinyl)-[3-fluoro-4-(trifluoromethoxy)phenyl]methyl]carbamoyl]pyridine-3-carboxylic acid |
| InChIKey | QEBYISWYMFIXOZ-INIZCTEOSA-N |
| SMILES | C1=CC(=C(N=C1)[C@H](C2=CC(=C(C=C2)OC(F)(F)F)F)NC(=O)C3=NC=C(C=C3)C(=O)O)F |
Computed by PubChem (NCBI)