CAS 1883548-84-2 appears in our catalog under these names: AMG PERK 44/ 99.81% (existing batch purity), AMG PERK 44, AMG PERK 44, AMG PERK 44 99%, 4-(2-Amino-4-methyl-3-(2-methylquinolin-6-yl)benzoyl)-1-methyl-2,5-diphenyl-1,2-dihydro-3H-pyrazol-3-one hydrochloride, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
4-[2-amino-4-methyl-3-(2-methylquinolin-6-yl)benzoyl]-1-methyl-2,5-diphenylpyrazol-3-one;hydrochloride (CAS 1883548-84-2) is a chemical compound with the molecular formula C34H29ClN4O2 and a molecular weight of 561.1 g/mol. IUPAC name: 4-[2-amino-4-methyl-3-(2-methylquinolin-6-yl)benzoyl]-1-methyl-2,5-diphenylpyrazol-3-one;hydrochloride. InChIKey: RNAKBTDDCHJCMT-UHFFFAOYSA-N.
| Molecular formula | C34H29ClN4O2 |
|---|---|
| Molecular weight | 561.1 g/mol |
| IUPAC name | 4-[2-amino-4-methyl-3-(2-methylquinolin-6-yl)benzoyl]-1-methyl-2,5-diphenylpyrazol-3-one;hydrochloride |
| InChIKey | RNAKBTDDCHJCMT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)C2=C(N(N(C2=O)C3=CC=CC=C3)C)C4=CC=CC=C4)N)C5=CC6=C(C=C5)N=C(C=C6)C.Cl |
Computed by PubChem (NCBI)