cas: 756526-06-4 — see every product listed under this CAS number, including other names
AMINO-PEG8-T-BUTYL ESTER, 95%, 95% (CAS 756526-06-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AEN-100mg |
| cas | 756526-06-4 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 10g | 1029.20 Pln | |
| Chemat | 25g | 2339.60 Pln | |
| Chemat | 100g | 8334.80 Pln | |
| Chemat | 250g | 15189.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 756526-06-4) is a chemical compound with the molecular formula C23H47NO10 and a molecular weight of 497.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: UMJVFHNJPJVDSB-UHFFFAOYSA-N.
| Molecular formula | C23H47NO10 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | UMJVFHNJPJVDSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)