CAS 756526-06-4 appears in our catalog under these names: Amino–PEG8–Boc, H2N-PEG(8)-CO-OtBu, Amino-dPEG®, t-Butyl Ester, AMINO-PEG8-T-BUTYL ESTER, 95%, 95%, Amino-PEG8-Boc, 99.85%. Offered by: GLPBio, Iris Biotech, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 1000mg, 5g, 10g, 25g, 100g.
Tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 756526-06-4) is a chemical compound with the molecular formula C23H47NO10 and a molecular weight of 497.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: UMJVFHNJPJVDSB-UHFFFAOYSA-N.
| Molecular formula | C23H47NO10 |
|---|---|
| Molecular weight | 497.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | UMJVFHNJPJVDSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)