CAS 2036074-41-4 appears in our catalog under these names: AMPA receptor modulator-1/ 98.82% (existing batch purity), AMPA receptor modulator–1, AMPA Receptor Modulator-1. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
5-[2-chloro-6-(trifluoromethoxy)phenyl]-7-methyl-1,3-dihydroindol-2-one (CAS 2036074-41-4) is a chemical compound with the molecular formula C16H11ClF3NO2 and a molecular weight of 341.71 g/mol. IUPAC name: 5-[2-chloro-6-(trifluoromethoxy)phenyl]-7-methyl-1,3-dihydroindol-2-one. InChIKey: AYAICAKEBFTALD-UHFFFAOYSA-N.
| Molecular formula | C16H11ClF3NO2 |
|---|---|
| Molecular weight | 341.71 g/mol |
| IUPAC name | 5-[2-chloro-6-(trifluoromethoxy)phenyl]-7-methyl-1,3-dihydroindol-2-one |
| InChIKey | AYAICAKEBFTALD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2)C3=C(C=CC=C3Cl)OC(F)(F)F |
Computed by PubChem (NCBI)