cas: 54301-15-4 — see every product listed under this CAS number, including other names
Amsacrine hydrochloride (CAS 54301-15-4) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 1g, 200mg, 25mg, 10mM (in 1ml dmso), 50mg, 500mg. Offered by: GLPBio, Sigma-Aldrich.
| brand | GLPBio |
|---|---|
| catalog number | GC11747-10 |
| cas | 54301-15-4 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 648.53 Pln | |
| GLPBio | 100mg | 1111.89 Pln | |
| GLPBio | 1g | 2324.14 Pln | |
| GLPBio | 200mg | 1378.68 Pln | |
| GLPBio | 25mg | 812.34 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 573.64 Pln | |
| GLPBio | 50mg | 915.31 Pln | |
| GLPBio | 500mg | 2094.80 Pln | |
| Sigma-Aldrich | 10MG | 1470.00 Pln | |
| Sigma-Aldrich | 50MG | 4410.00 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;hydrochloride (CAS 54301-15-4) is a chemical compound with the molecular formula C21H20ClN3O3S and a molecular weight of 429.9 g/mol. IUPAC name: N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;hydrochloride. InChIKey: WDISRLXRMMTXEV-UHFFFAOYSA-N.
| Molecular formula | C21H20ClN3O3S |
|---|---|
| Molecular weight | 429.9 g/mol |
| IUPAC name | N-[4-(acridin-9-ylamino)-3-methoxyphenyl]methanesulfonamide;hydrochloride |
| InChIKey | WDISRLXRMMTXEV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)NS(=O)(=O)C)NC2=C3C=CC=CC3=NC4=CC=CC=C42.Cl |
Computed by PubChem (NCBI)