CAS 926023-82-7 appears in our catalog under these names: AMTB hydrochloride, AMTB hydrochloride/ 99.51% (existing batch purity), AMTB hydrochloride, AMTB HCl 97%, N-(3-Aminopropyl)-2-((3-methylbenzyl)oxy)-N-(thiophen-2-ylmethyl)benzamide hydrochloride, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 1mg, 2mg, 5mg, 25mg, 100mg, 500mg.
N-(3-aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(thiophen-2-ylmethyl)benzamide;hydrochloride (CAS 926023-82-7) is a chemical compound with the molecular formula C23H27ClN2O2S and a molecular weight of 431.0 g/mol. IUPAC name: N-(3-aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(thiophen-2-ylmethyl)benzamide;hydrochloride. InChIKey: UDXGBANGPYONOK-UHFFFAOYSA-N.
| Molecular formula | C23H27ClN2O2S |
|---|---|
| Molecular weight | 431.0 g/mol |
| IUPAC name | N-(3-aminopropyl)-2-[(3-methylphenyl)methoxy]-N-(thiophen-2-ylmethyl)benzamide;hydrochloride |
| InChIKey | UDXGBANGPYONOK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)COC2=CC=CC=C2C(=O)N(CCCN)CC3=CC=CS3.Cl |
Computed by PubChem (NCBI)