Products 959850-74-9
CAS 959850-74-9 appears in our catalog under these names: AP1189 acetate, AP1189 acetate/ 98.73% (existing batch purity), (E)-N-(Trans-3-{1-(2-nitrophenyl)-1H-pyrrol-2-yl} allylidenamino)guanidinium acetate, AP1189 (acetate), (E/Z)-Resomelagon (acetate). Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 200mg, 25mg, 5mg, 50mg, 1mg, 25 mg.
Acetic acid;2-[(E)-[(E)-3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]amino]guanidine (CAS 959850-74-9) is a chemical compound with the molecular formula C16H18N6O4 and a molecular weight of 358.35 g/mol. IUPAC name: acetic acid;2-[(E)-[(E)-3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]amino]guanidine. InChIKey: FIESOFUABUPMMH-WAJHRQJSSA-N.
| Molecular formula | C16H18N6O4 |
|---|---|
| Molecular weight | 358.35 g/mol |
| IUPAC name | acetic acid;2-[(E)-[(E)-3-[1-(2-nitrophenyl)pyrrol-2-yl]prop-2-enylidene]amino]guanidine |
| InChIKey | FIESOFUABUPMMH-WAJHRQJSSA-N |
| SMILES | CC(=O)O.C1=CC=C(C(=C1)N2C=CC=C2/C=C/C=N/N=C(N)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)