CAS 89705-21-5 appears in our catalog under these names: APNEA/ 99.58% (existing batch purity), N6-2-(4-Aminophenyl)ethyladenosine, APNEA 98%, APNEA, ≥97%, ≥97%, APNEA, 98.96%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 5mg, 10mg, 250mg, 1g, 10mM/1mL.
(2R,3R,4S,5R)-2-[6-[2-(4-aminophenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 89705-21-5) is a chemical compound with the molecular formula C18H22N6O4 and a molecular weight of 386.4 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[6-[2-(4-aminophenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: XTPOZVLRZZIEBW-SCFUHWHPSA-N.
| Molecular formula | C18H22N6O4 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[6-[2-(4-aminophenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | XTPOZVLRZZIEBW-SCFUHWHPSA-N |
| SMILES | C1=CC(=CC=C1CCNC2=C3C(=NC=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)N |
Computed by PubChem (NCBI)