CAS 1216665-49-4 appears in our catalog under these names: APY29/ 98.46% (existing batch purity), APY29, APY29 98%, N2-(1H-Benzo[d]imidazol-6-yl)-N4-(5-cyclopropyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine, 98%, 98%, APY29, 99.90%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1mg.
2-N-(3H-benzimidazol-5-yl)-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine (CAS 1216665-49-4) is a chemical compound with the molecular formula C17H16N8 and a molecular weight of 332.4 g/mol. IUPAC name: 2-N-(3H-benzimidazol-5-yl)-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine. InChIKey: WJNBSTLIALIIEW-UHFFFAOYSA-N.
| Molecular formula | C17H16N8 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2-N-(3H-benzimidazol-5-yl)-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine |
| InChIKey | WJNBSTLIALIIEW-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NN2)NC3=NC(=NC=C3)NC4=CC5=C(C=C4)N=CN5 |
Computed by PubChem (NCBI)