CAS 1613710-01-2 appears in our catalog under these names: ARN–3236, ARN-3236/ 99.57% (existing batch purity), ARN-3236 98%, 3-(2,4-Dimethoxyphenyl)-4-(3-thienyl)-1H-pyrrolo[2,3-b]pyridine, 98%, 98%, ARN-3236, 99.66%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(2,4-dimethoxyphenyl)-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine (CAS 1613710-01-2) is a chemical compound with the molecular formula C19H16N2O2S and a molecular weight of 336.4 g/mol. IUPAC name: 3-(2,4-dimethoxyphenyl)-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine. InChIKey: WEHOIIGXTMKVRG-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 3-(2,4-dimethoxyphenyl)-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | WEHOIIGXTMKVRG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CNC3=NC=CC(=C23)C4=CSC=C4)OC |
Computed by PubChem (NCBI)