CAS 949898-66-2 appears in our catalog under these names: AS-136A/ 99.96% (existing batch purity), 2-Methyl-N-(4-piperidin-1-ylsulfonylphenyl)-5-(trifluoromethyl)pyrazole-3-carboxamide, ML020, AS-136A, 99.67%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
1-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide (CAS 949898-66-2) is a chemical compound with the molecular formula C17H19F3N4O3S and a molecular weight of 416.4 g/mol. IUPAC name: 1-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide. InChIKey: OJDLQNVQEAZKSL-UHFFFAOYSA-N.
| Molecular formula | C17H19F3N4O3S |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | 1-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-3-(trifluoromethyl)pyrazole-5-carboxamide |
| InChIKey | OJDLQNVQEAZKSL-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C(=O)NC2=CC=C(C=C2)S(=O)(=O)N3CCCCC3 |
Computed by PubChem (NCBI)