AS-252424 99%
cas: 900515-16-4 — see every product listed under this CAS number, including other names
AS-252424 99% (CAS 900515-16-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A942298-5mg |
| cas | 900515-16-4 |
| size | 5mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 420.44 Pln | |
| Ambeed | 10mg | 715.25 Pln | |
| Ambeed | 25mg | 1672.00 Pln | |
| Ambeed | 50mg | 2795.62 Pln | |
| Ambeed | 100mg | 4425.44 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A942298 |
(5Z)-5-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (CAS 900515-16-4) is a chemical compound with the molecular formula C14H8FNO4S and a molecular weight of 305.28 g/mol. IUPAC name: (5Z)-5-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: OYYVWNDMOQPMGE-SDQBBNPISA-N.
| Molecular formula | C14H8FNO4S |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | (5Z)-5-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | OYYVWNDMOQPMGE-SDQBBNPISA-N |
| SMILES | C1=CC(=C(C=C1F)O)C2=CC=C(O2)/C=C\3/C(=O)NC(=O)S3 |
Computed by PubChem (NCBI)
Synonyms:
(Z)-5-((5-(4-fluoro-2-hydroxyphenyl)furan-2-yl)methylene)thiazolidine-2,4-dione, (5Z)-5-[[5-(4-Fluoro-2-hydroxyphenyl)-2-furanyl]methylene]-2,4-thiazolidinedione, (E)-5-((5-(4-fluoro-2-hydroxyphenyl)furan-2-yl)methylene)thiazolidine-2,4-dione, orb1223709, orb1300979, Tox21_500157, (5Z)-5-[[5-(4-fluoro-2-hydroxy, compound 26 [PMID: 16789742]