CAS 900515-16-4 appears in our catalog under these names: (5Z)-5-{[5-(4-Fluoro-2-hydroxyphenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione, 95%, AS-252424, AS–252424, AS-252424/ 99.26% (existing batch purity), AS 252424. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 10mg, 1mg, 2mg, 50mg.
(5Z)-5-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (CAS 900515-16-4) is a chemical compound with the molecular formula C14H8FNO4S and a molecular weight of 305.28 g/mol. IUPAC name: (5Z)-5-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: OYYVWNDMOQPMGE-SDQBBNPISA-N.
| Molecular formula | C14H8FNO4S |
|---|---|
| Molecular weight | 305.28 g/mol |
| IUPAC name | (5Z)-5-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | OYYVWNDMOQPMGE-SDQBBNPISA-N |
| SMILES | C1=CC(=C(C=C1F)O)C2=CC=C(O2)/C=C\3/C(=O)NC(=O)S3 |
Computed by PubChem (NCBI)