CAS 908112-37-8 appears in our catalog under these names: AT-533, 98%, AT-533/ 99.54% (existing batch purity), AT–533, AT-533 99%, AT-533. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
2-[(4-hydroxycyclohexyl)amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide (CAS 908112-37-8) is a chemical compound with the molecular formula C23H30N4O3 and a molecular weight of 410.5 g/mol. IUPAC name: 2-[(4-hydroxycyclohexyl)amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide. InChIKey: FMOSGTTYAFQMSD-UHFFFAOYSA-N.
| Molecular formula | C23H30N4O3 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 2-[(4-hydroxycyclohexyl)amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindazol-1-yl)benzamide |
| InChIKey | FMOSGTTYAFQMSD-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=O)CC(C2)(C)C)C3=CC(=C(C=C3)C(=O)N)NC4CCC(CC4)O |
Computed by PubChem (NCBI)