CAS 257892-33-4 appears in our catalog under these names: N-(3,5-Dichloropyridin-4-yl)-2-[1-(4-fluorobenzyl)-5-hydroxy-1H-indol-3-yl]-2-oxo-acetamide, AWD 12-281/ 99.95% (existing batch purity), AWD 12-281. Offered by: Chemat, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg, 10 mg.
N-(3,5-dichloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-hydroxyindol-3-yl]-2-oxoacetamide (CAS 257892-33-4) is a chemical compound with the molecular formula C22H14Cl2FN3O3 and a molecular weight of 458.3 g/mol. IUPAC name: N-(3,5-dichloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-hydroxyindol-3-yl]-2-oxoacetamide. InChIKey: DPHDSIQHVGSITN-UHFFFAOYSA-N.
| Molecular formula | C22H14Cl2FN3O3 |
|---|---|
| Molecular weight | 458.3 g/mol |
| IUPAC name | N-(3,5-dichloro-4-pyridinyl)-2-[1-[(4-fluorophenyl)methyl]-5-hydroxyindol-3-yl]-2-oxoacetamide |
| InChIKey | DPHDSIQHVGSITN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C3=C2C=CC(=C3)O)C(=O)C(=O)NC4=C(C=NC=C4Cl)Cl)F |
Computed by PubChem (NCBI)