CAS 1290628-31-7 appears in our catalog under these names: AZ 12216052, AZ12216052/ 99.29% (existing batch purity), AZ 12216052, 2-((4-Bromobenzyl)thio)-N-(4-(sec-butyl)phenyl)acetamide, 97%, 97%, AZ 12216052, 99.42%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 10 mg.
2-[(4-bromophenyl)methylsulfanyl]-N-(4-butan-2-ylphenyl)acetamide (CAS 1290628-31-7) is a chemical compound with the molecular formula C19H22BrNOS and a molecular weight of 392.4 g/mol. IUPAC name: 2-[(4-bromophenyl)methylsulfanyl]-N-(4-butan-2-ylphenyl)acetamide. InChIKey: QKUYZJOTWYRWNF-UHFFFAOYSA-N.
| Molecular formula | C19H22BrNOS |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methylsulfanyl]-N-(4-butan-2-ylphenyl)acetamide |
| InChIKey | QKUYZJOTWYRWNF-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC=C(C=C1)NC(=O)CSCC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)