Products 942507-42-8
CAS 942507-42-8 appears in our catalog under these names: AZ304/ 99.83% (existing batch purity), AZ304, AZ304 99%, 3-(2-Cyanopropan-2-yl)-N-(3-((7-methoxyquinazolin-4-yl)amino)-4-methylphenyl)benzamide, 99%, 99%, AZ304, 99.77%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 5mg, 10mM (in 1ml dmso), 1mg, 250mg.
3-(2-cyanopropan-2-yl)-N-[3-[(7-methoxyquinazolin-4-yl)amino]-4-methylphenyl]benzamide (CAS 942507-42-8) is a chemical compound with the molecular formula C27H25N5O2 and a molecular weight of 451.5 g/mol. IUPAC name: 3-(2-cyanopropan-2-yl)-N-[3-[(7-methoxyquinazolin-4-yl)amino]-4-methylphenyl]benzamide. InChIKey: NGWQZRWVYYFTHC-UHFFFAOYSA-N.
| Molecular formula | C27H25N5O2 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | 3-(2-cyanopropan-2-yl)-N-[3-[(7-methoxyquinazolin-4-yl)amino]-4-methylphenyl]benzamide |
| InChIKey | NGWQZRWVYYFTHC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=CC=C2)C(C)(C)C#N)NC3=NC=NC4=C3C=CC(=C4)OC |
Computed by PubChem (NCBI)