Products 1124329-14-1
CAS 1124329-14-1 appears in our catalog under these names: AZ3146/ 98.03% (existing batch purity), AZ3146, AZ 3146, AZ3146 98+%, AZ3146, 98+%, 98+%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)oxyanilino]-7-methylpurin-8-one (CAS 1124329-14-1) is a chemical compound with the molecular formula C24H32N6O3 and a molecular weight of 452.5 g/mol. IUPAC name: 9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)oxyanilino]-7-methylpurin-8-one. InChIKey: YUKWVHPTFRQHMF-UHFFFAOYSA-N.
| Molecular formula | C24H32N6O3 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | 9-cyclopentyl-2-[2-methoxy-4-(1-methylpiperidin-4-yl)oxyanilino]-7-methylpurin-8-one |
| InChIKey | YUKWVHPTFRQHMF-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)OC2=CC(=C(C=C2)NC3=NC=C4C(=N3)N(C(=O)N4C)C5CCCC5)OC |
Computed by PubChem (NCBI)