CAS 1825345-33-2 appears in our catalog under these names: AZ9482/ 99.29% (existing batch purity), AZ9482, AZ9482, 98%, 98%, AZ9482, 99.80%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-[3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]pyridine-3-carbonitrile (CAS 1825345-33-2) is a chemical compound with the molecular formula C26H22N6O2 and a molecular weight of 450.5 g/mol. IUPAC name: 2-[4-[3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]pyridine-3-carbonitrile. InChIKey: ZDDPBFWHZOJFHF-UHFFFAOYSA-N.
| Molecular formula | C26H22N6O2 |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | 2-[4-[3-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoyl]piperazin-1-yl]pyridine-3-carbonitrile |
| InChIKey | ZDDPBFWHZOJFHF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=C(C=CC=N2)C#N)C(=O)C3=CC=CC(=C3)CC4=NNC(=O)C5=CC=CC=C54 |
Computed by PubChem (NCBI)