CAS 1101810-02-9 appears in our catalog under these names: AZD 3147/ 98.34% (existing batch purity), AZD 3147, AZD3147, AZD 3147, ≥98%(HPLC), ≥98%(HPLC), AZD3147, 99.93%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 100 mg, 10 mg.
1-[4-[4-(1-cyclopropylsulfonylcyclopropyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea (CAS 1101810-02-9) is a chemical compound with the molecular formula C24H31N5O4S2 and a molecular weight of 517.7 g/mol. IUPAC name: 1-[4-[4-(1-cyclopropylsulfonylcyclopropyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea. InChIKey: JWGVUDPAMQEIJU-INIZCTEOSA-N.
| Molecular formula | C24H31N5O4S2 |
|---|---|
| Molecular weight | 517.7 g/mol |
| IUPAC name | 1-[4-[4-(1-cyclopropylsulfonylcyclopropyl)-6-[(3S)-3-methylmorpholin-4-yl]pyrimidin-2-yl]phenyl]-3-(2-hydroxyethyl)thiourea |
| InChIKey | JWGVUDPAMQEIJU-INIZCTEOSA-N |
| SMILES | C[C@H]1COCCN1C2=NC(=NC(=C2)C3(CC3)S(=O)(=O)C4CC4)C5=CC=C(C=C5)NC(=S)NCCO |
Computed by PubChem (NCBI)