CAS 327056-26-8 appears in our catalog under these names: AZD 9272, AZD 9272/ 97.53% (existing batch purity), AZD 9272, 3-Fluoro-5-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile, 98%, 98%, AZD 9272, 99.87%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 250mg, 5 mg.
3-fluoro-5-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile (CAS 327056-26-8) is a chemical compound with the molecular formula C14H6F2N4O and a molecular weight of 284.22 g/mol. IUPAC name: 3-fluoro-5-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile. InChIKey: RBSPCALDSNXWEP-UHFFFAOYSA-N.
| Molecular formula | C14H6F2N4O |
|---|---|
| Molecular weight | 284.22 g/mol |
| IUPAC name | 3-fluoro-5-[3-(5-fluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]benzonitrile |
| InChIKey | RBSPCALDSNXWEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1F)C2=NOC(=N2)C3=CC(=CC(=C3)C#N)F |
Computed by PubChem (NCBI)