CAS 1174043-16-3 appears in our catalog under these names: AZD-2461/ 98.11% (existing batch purity), AZD2461, AZD-2461 99%, AZD2461, 99%, 99%, AZD-2461, 99.79%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
4-[[4-fluoro-3-(4-methoxypiperidine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one (CAS 1174043-16-3) is a chemical compound with the molecular formula C22H22FN3O3 and a molecular weight of 395.4 g/mol. IUPAC name: 4-[[4-fluoro-3-(4-methoxypiperidine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one. InChIKey: HYNBNUYQTQIHJK-UHFFFAOYSA-N.
| Molecular formula | C22H22FN3O3 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 4-[[4-fluoro-3-(4-methoxypiperidine-1-carbonyl)phenyl]methyl]-2H-phthalazin-1-one |
| InChIKey | HYNBNUYQTQIHJK-UHFFFAOYSA-N |
| SMILES | COC1CCN(CC1)C(=O)C2=C(C=CC(=C2)CC3=NNC(=O)C4=CC=CC=C43)F |
Computed by PubChem (NCBI)