CAS 2756333-39-6 appears in our catalog under these names: AZD-9574/ 98.39% (existing batch purity), AZD–9574, AZD-9574 98%, AZD-9574, 98%, 98%, Palacaparib, 98.30%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide (CAS 2756333-39-6) is a chemical compound with the molecular formula C21H22F2N6O2 and a molecular weight of 428.4 g/mol. IUPAC name: 6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide. InChIKey: WXRCLFFPZXJCLS-UHFFFAOYSA-N.
| Molecular formula | C21H22F2N6O2 |
|---|---|
| Molecular weight | 428.4 g/mol |
| IUPAC name | 6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| InChIKey | WXRCLFFPZXJCLS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=C(C=C2)CN3CCN(CC3)C4=C(N=C(C=C4)C(=O)NC)F)F)NC1=O |
Computed by PubChem (NCBI)