cas: 919351-41-0 — see every product listed under this CAS number, including other names
AZD1283 (CAS 919351-41-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 500mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC14956-10 |
| cas | 919351-41-0 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1252.31 Pln | |
| GLPBio | 100mg | 3424.06 Pln | |
| GLPBio | 5mg | 896.59 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 966.80 Pln | |
| GLPBio | 50mg | 2473.92 Pln | |
| Chemat | 5mg | 669.20 Pln | |
| Chemat | 10mg | 846.80 Pln | |
| Chemat | 50mg | 3746.00 Pln | |
| Chemat | 1mg | 496.40 Pln | |
| Chemat | 100mg | 6640.40 Pln | |
| Chemat | 500mg | 13158.80 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 6-[4-(benzylsulfonylcarbamoyl)piperidin-1-yl]-5-cyano-2-methylpyridine-3-carboxylate (CAS 919351-41-0) is a chemical compound with the molecular formula C23H26N4O5S and a molecular weight of 470.5 g/mol. IUPAC name: ethyl 6-[4-(benzylsulfonylcarbamoyl)piperidin-1-yl]-5-cyano-2-methylpyridine-3-carboxylate. InChIKey: NEMHKCNXXRQYRF-UHFFFAOYSA-N.
| Molecular formula | C23H26N4O5S |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | ethyl 6-[4-(benzylsulfonylcarbamoyl)piperidin-1-yl]-5-cyano-2-methylpyridine-3-carboxylate |
| InChIKey | NEMHKCNXXRQYRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C(=C1)C#N)N2CCC(CC2)C(=O)NS(=O)(=O)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)