CAS 919351-41-0 appears in our catalog under these names: Azd1283, 95%, AZD1283/ 98.37% (existing batch purity), AZD1283, AZD 1283, AZD1283, 99.33%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
Ethyl 6-[4-(benzylsulfonylcarbamoyl)piperidin-1-yl]-5-cyano-2-methylpyridine-3-carboxylate (CAS 919351-41-0) is a chemical compound with the molecular formula C23H26N4O5S and a molecular weight of 470.5 g/mol. IUPAC name: ethyl 6-[4-(benzylsulfonylcarbamoyl)piperidin-1-yl]-5-cyano-2-methylpyridine-3-carboxylate. InChIKey: NEMHKCNXXRQYRF-UHFFFAOYSA-N.
| Molecular formula | C23H26N4O5S |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | ethyl 6-[4-(benzylsulfonylcarbamoyl)piperidin-1-yl]-5-cyano-2-methylpyridine-3-carboxylate |
| InChIKey | NEMHKCNXXRQYRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C(=C1)C#N)N2CCC(CC2)C(=O)NS(=O)(=O)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)