CAS 1240299-33-5 appears in our catalog under these names: AZD3514, AZD3514/ 96.6% (existing batch purity), AZD 3514, AZD3514 99%, AZD3514, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 50mg, 25mg, 1mg, 10 mg.
1-[4-[2-[4-[1-[3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]phenoxy]ethyl]piperazin-1-yl]ethanone (CAS 1240299-33-5) is a chemical compound with the molecular formula C25H32F3N7O2 and a molecular weight of 519.6 g/mol. IUPAC name: 1-[4-[2-[4-[1-[3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]phenoxy]ethyl]piperazin-1-yl]ethanone. InChIKey: JMEYDSHPKCSIJC-UHFFFAOYSA-N.
| Molecular formula | C25H32F3N7O2 |
|---|---|
| Molecular weight | 519.6 g/mol |
| IUPAC name | 1-[4-[2-[4-[1-[3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperidin-4-yl]phenoxy]ethyl]piperazin-1-yl]ethanone |
| InChIKey | JMEYDSHPKCSIJC-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)CCOC2=CC=C(C=C2)C3CCN(CC3)C4=NN5C(=NN=C5C(F)(F)F)CC4 |
Computed by PubChem (NCBI)