CAS 892489-52-0 appears in our catalog under these names: AZD3988/ 99.82% (existing batch purity), AZD 3988, AZD 3988, AZD3988 98%, AZD3988, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 50mg, 1mg, 25mg, 100mg, 250mg.
2-[4-[4-[[5-(3,4-difluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid (CAS 892489-52-0) is a chemical compound with the molecular formula C23H22F2N4O4 and a molecular weight of 456.4 g/mol. IUPAC name: 2-[4-[4-[[5-(3,4-difluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid. InChIKey: NGEBYTLALFOQKI-UHFFFAOYSA-N.
| Molecular formula | C23H22F2N4O4 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | 2-[4-[4-[[5-(3,4-difluoroanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid |
| InChIKey | NGEBYTLALFOQKI-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CC(=O)O)C2=CC=C(C=C2)NC(=O)C3=NN=C(O3)NC4=CC(=C(C=C4)F)F |
Computed by PubChem (NCBI)