CAS 453566-30-8 appears in our catalog under these names: AZD6538/ 98.68% (existing batch purity), AZD6538, AZD6538, 95%, 95%, AZD6538, 99.21%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10 mg.
6-[5-(3-cyano-5-fluorophenyl)-1,2,4-oxadiazol-3-yl]pyridine-3-carbonitrile (CAS 453566-30-8) is a chemical compound with the molecular formula C15H6FN5O and a molecular weight of 291.24 g/mol. IUPAC name: 6-[5-(3-cyano-5-fluorophenyl)-1,2,4-oxadiazol-3-yl]pyridine-3-carbonitrile. InChIKey: PBVKGEMPZBKZOA-UHFFFAOYSA-N.
| Molecular formula | C15H6FN5O |
|---|---|
| Molecular weight | 291.24 g/mol |
| IUPAC name | 6-[5-(3-cyano-5-fluorophenyl)-1,2,4-oxadiazol-3-yl]pyridine-3-carbonitrile |
| InChIKey | PBVKGEMPZBKZOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C#N)C2=NOC(=N2)C3=CC(=CC(=C3)C#N)F |
Computed by PubChem (NCBI)