CAS 942437-37-8 appears in our catalog under these names: AZD7325/ 99.88% (existing batch purity), AZD7325, AZD7325 97%, 4-Amino-8-(2-fluoro-6-methoxyphenyl)-N-propylcinnoline-3-carboxamide, 97%, 97%, AZD7325, 99.95%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg, 250mg.
4-amino-8-(2-fluoro-6-methoxyphenyl)-N-propylcinnoline-3-carboxamide (CAS 942437-37-8) is a chemical compound with the molecular formula C19H19FN4O2 and a molecular weight of 354.4 g/mol. IUPAC name: 4-amino-8-(2-fluoro-6-methoxyphenyl)-N-propylcinnoline-3-carboxamide. InChIKey: KYDURMHFWXCKMW-UHFFFAOYSA-N.
| Molecular formula | C19H19FN4O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-amino-8-(2-fluoro-6-methoxyphenyl)-N-propylcinnoline-3-carboxamide |
| InChIKey | KYDURMHFWXCKMW-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)C1=NN=C2C(=C1N)C=CC=C2C3=C(C=CC=C3F)OC |
Computed by PubChem (NCBI)