Products 1126366-36-6
CAS 1126366-36-6 appears in our catalog under these names: AZD8542/ 99.96% (existing batch purity), AZD8542, AZD8542, 99.49%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
N-[2,4-dimethyl-5-(1-methylimidazol-4-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide (CAS 1126366-36-6) is a chemical compound with the molecular formula C25H24N4O2 and a molecular weight of 412.5 g/mol. IUPAC name: N-[2,4-dimethyl-5-(1-methylimidazol-4-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide. InChIKey: SMQVBAGSZVHCJP-UHFFFAOYSA-N.
| Molecular formula | C25H24N4O2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | N-[2,4-dimethyl-5-(1-methylimidazol-4-yl)phenyl]-4-(pyridin-2-ylmethoxy)benzamide |
| InChIKey | SMQVBAGSZVHCJP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CN(C=N2)C)NC(=O)C3=CC=C(C=C3)OCC4=CC=CC=N4)C |
Computed by PubChem (NCBI)