CAS 948845-91-8 appears in our catalog under these names: Abt-288/ 98.84% (existing batch purity), ABT-288. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
2-[4-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]phenyl]pyridazin-3-one (CAS 948845-91-8) is a chemical compound with the molecular formula C23H24N4O and a molecular weight of 372.5 g/mol. IUPAC name: 2-[4-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]phenyl]pyridazin-3-one. InChIKey: GNIRITULTPTAQW-KNQAVFIVSA-N.
| Molecular formula | C23H24N4O |
|---|---|
| Molecular weight | 372.5 g/mol |
| IUPAC name | 2-[4-[4-[(3aR,6aR)-5-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]phenyl]phenyl]pyridazin-3-one |
| InChIKey | GNIRITULTPTAQW-KNQAVFIVSA-N |
| SMILES | CN1C[C@H]2CCN([C@H]2C1)C3=CC=C(C=C3)C4=CC=C(C=C4)N5C(=O)C=CC=N5 |
Computed by PubChem (NCBI)