Ac4GalNAz 95%
cas: 653600-56-7 — see every product listed under this CAS number, including other names
Ac4GalNAz 95% (CAS 653600-56-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1004695-25mg |
| cas | 653600-56-7 |
| size | 25mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 704.12 Pln | |
| Ambeed | 50mg | 1249.25 Pln | |
| Ambeed | 100mg | 2089.19 Pln | |
| Ambeed | 250mg | 3919.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1004695 |
[(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate (CAS 653600-56-7) is a chemical compound with the molecular formula C16H22N4O10 and a molecular weight of 430.37 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate. InChIKey: HGMISDAXLUIXKM-YJUJGKJLSA-N.
| Molecular formula | C16H22N4O10 |
|---|---|
| Molecular weight | 430.37 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate |
| InChIKey | HGMISDAXLUIXKM-YJUJGKJLSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)