CAS 653600-56-7 appears in our catalog under these names: Ac4galnaz, 95%, Ac4GalNAz/ 98.31% (existing batch purity), Ac4GalNAz, 1,3,4,6-Tetra-O-acetyl-N-azidoacetylgalactosamine, N-AZIDOACETYLGALACTOSAMINE-TETRAACYLATED. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 100mg, 2mg, 5mg, 10mg, 25mg, 50mg, 250mg, 5 mg.
[(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate (CAS 653600-56-7) is a chemical compound with the molecular formula C16H22N4O10 and a molecular weight of 430.37 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate. InChIKey: HGMISDAXLUIXKM-YJUJGKJLSA-N.
| Molecular formula | C16H22N4O10 |
|---|---|
| Molecular weight | 430.37 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4,6-triacetyloxy-5-[(2-azidoacetyl)amino]oxan-2-yl]methyl acetate |
| InChIKey | HGMISDAXLUIXKM-YJUJGKJLSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@@H]([C@@H]([C@H](C(O1)OC(=O)C)NC(=O)CN=[N+]=[N-])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)